C20H43N7O2 — CID 144745617
1-(2,6-diaminohexyl)-N-[6-(diaminomethylideneamino)-2-oxohexan-3-yl]pyrrolidine-2-carboxamide;ethane (PubChem CID 144745617) has the molecular formula C20H43N7O2 and a molecular weight of 413.61 g/mol. Its IUPAC name is 1-(2,6-diaminohexyl)-N-[6-(diaminomethylideneamino)-2-oxohexan-3-yl]pyrrolidine-2-carboxamide;ethane.
| Compound Name | 1-(2,6-diaminohexyl)-N-[6-(diaminomethylideneamino)-2-oxohexan-3-yl]pyrrolidine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 144745617 |
| Molecular Formula | C20H43N7O2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.35 |
| IUPAC Name | 1-(2,6-diaminohexyl)-N-[6-(diaminomethylideneamino)-2-oxohexan-3-yl]pyrrolidine-2-carboxamide;ethane |
| SMILES | CC.CC(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1CC(N)CCCCN |
| InChI | InChI=1S/C18H37N7O2.C2H6/c1-13(26)15(7-4-10-23-18(21)22)24-17(27)16-8-5-11-25(16)12-14(20)6-2-3-9-19;1-2/h14-16H,2-12,19-20H2,1H3,(H,24,27)(H4,21,22,23);1-2H3 |
| InChIKey | JEZLIEJCEOAQGE-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 165.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|