C10H14N2 — CID 144745986
2-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,2-dihydropyrimidine (PubChem CID 144745986) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,2-dihydropyrimidine.
| Compound Name | 2-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,2-dihydropyrimidine |
|---|---|
| PubChem CID | 144745986 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,2-dihydropyrimidine |
| SMILES | C=C/C(=C\C)C1=CNC(C)N=C1 |
| InChI | InChI=1S/C10H14N2/c1-4-9(5-2)10-6-11-8(3)12-7-10/h4-8,11H,1H2,2-3H3/b9-5+ |
| InChIKey | MRDRCPWXUHJBEZ-WEVVVXLNSA-N |
| XLogP | 2.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|