C13H13NO — CID 144746531
4-(5-but-1-ynyl-3-pyridinyl)but-3-yn-1-ol (PubChem CID 144746531) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 4-(5-but-1-ynyl-3-pyridinyl)but-3-yn-1-ol.
| Compound Name | 4-(5-but-1-ynyl-3-pyridinyl)but-3-yn-1-ol |
|---|---|
| PubChem CID | 144746531 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 4-(5-but-1-ynyl-3-pyridinyl)but-3-yn-1-ol |
| SMILES | CCC#Cc1cncc(C#CCCO)c1 |
| InChI | InChI=1S/C13H13NO/c1-2-3-6-12-9-13(11-14-10-12)7-4-5-8-15/h9-11,15H,2,5,8H2,1H3 |
| InChIKey | IGKSDTMQWZJWDO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|