C17H29N3O7 — CID 144746809
[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino] 2-hydroxycyclopentane-1-carboxylate (PubChem CID 144746809) has the molecular formula C17H29N3O7 and a molecular weight of 387.43 g/mol. Its IUPAC name is [bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino] 2-hydroxycyclopentane-1-carboxylate.
| Compound Name | [bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino] 2-hydroxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 144746809 |
| Molecular Formula | C17H29N3O7 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | [bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino] 2-hydroxycyclopentane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NC(=NOC(=O)C1CCCC1O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29N3O7/c1-16(2,3)25-14(23)18-13(19-15(24)26-17(4,5)6)20-27-12(22)10-8-7-9-11(10)21/h10-11,21H,7-9H2,1-6H3,(H2,18,19,20,23,24) |
| InChIKey | OARVHGAVIASELW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 135.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|