C16H24N6OS — CID 144752977
(Z)-2-[[[6-(4-ethylpiperazin-1-yl)-2-methylpyrimidin-4-yl]amino]methylsulfanyl]-3-(methylideneamino)prop-2-enal (PubChem CID 144752977) has the molecular formula C16H24N6OS and a molecular weight of 348.48 g/mol. Its IUPAC name is (Z)-2-[[[6-(4-ethylpiperazin-1-yl)-2-methylpyrimidin-4-yl]amino]methylsulfanyl]-3-(methylideneamino)prop-2-enal.
| Compound Name | (Z)-2-[[[6-(4-ethylpiperazin-1-yl)-2-methylpyrimidin-4-yl]amino]methylsulfanyl]-3-(methylideneamino)prop-2-enal |
|---|---|
| PubChem CID | 144752977 |
| Molecular Formula | C16H24N6OS |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (Z)-2-[[[6-(4-ethylpiperazin-1-yl)-2-methylpyrimidin-4-yl]amino]methylsulfanyl]-3-(methylideneamino)prop-2-enal |
| SMILES | C=N/C=C(/C=O)SCNc1cc(N2CCN(CC)CC2)nc(C)n1 |
| InChI | InChI=1S/C16H24N6OS/c1-4-21-5-7-22(8-6-21)16-9-15(19-13(2)20-16)18-12-24-14(11-23)10-17-3/h9-11H,3-8,12H2,1-2H3,(H,18,19,20)/b14-10- |
| InChIKey | HXQIICVVWYBUDH-UVTDQMKNSA-N |
| XLogP | 1.77 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|