About (5Z)-3-methylidene-N-[1-(1-propan-2-ylazetidin-3-yl)ethenyl]hepta-1,5-dien-4-imine
(5Z)-3-methylidene-N-[1-(1-propan-2-ylazetidin-3-yl)ethenyl]hepta-1,5-dien-4-imine (PubChem CID 144758061) has the molecular formula C16H24N2
and a molecular weight of 244.38 g/mol. Its IUPAC name is (5Z)-3-methylidene-N-[1-(1-propan-2-ylazetidin-3-yl)ethenyl]hepta-1,5-dien-4-imine.
Molecular Properties
| Compound Name | (5Z)-3-methylidene-N-[1-(1-propan-2-ylazetidin-3-yl)ethenyl]hepta-1,5-dien-4-imine |
| PubChem CID | 144758061 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (5Z)-3-methylidene-N-[1-(1-propan-2-ylazetidin-3-yl)ethenyl]hepta-1,5-dien-4-imine |
| SMILES | C=CC(=C)C(/C=C\C)=NC(=C)C1CN(C(C)C)C1 |
| InChI | InChI=1S/C16H24N2/c1-7-9-16(13(5)8-2)17-14(6)15-10-18(11-15)12(3)4/h7-9,12,15H,2,5-6,10-11H2,1,3-4H3/b9-7-,17-16- |
| InChIKey | FKSILRZYYWPAAU-DQUKDVETSA-N |
| XLogP | 3.60 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-3-methylidene-N-[1-(1-propan-2-ylazetidin-3-yl)ethenyl]hepta-1,5-dien-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-3-methylidene-N-[1-(1-propan-2-ylazetidin-3-yl)ethenyl]hepta-1,5-dien-4-imine?
The IUPAC name of (5Z)-3-methylidene-N-[1-(1-propan-2-ylazetidin-3-yl)ethenyl]hepta-1,5-dien-4-imine (CID 144758061) is (5Z)-3-methylidene-N-[1-(1-propan-2-ylazetidin-3-yl)ethenyl]hepta-1,5-dien-4-imine.
What is the SMILES notation for (5Z)-3-methylidene-N-[1-(1-propan-2-ylazetidin-3-yl)ethenyl]hepta-1,5-dien-4-imine?
The canonical SMILES for (5Z)-3-methylidene-N-[1-(1-propan-2-ylazetidin-3-yl)ethenyl]hepta-1,5-dien-4-imine is C=CC(=C)C(/C=C\C)=NC(=C)C1CN(C(C)C)C1.
What is the InChIKey of (5Z)-3-methylidene-N-[1-(1-propan-2-ylazetidin-3-yl)ethenyl]hepta-1,5-dien-4-imine?
The InChIKey is FKSILRZYYWPAAU-DQUKDVETSA-N. The full InChI is InChI=1S/C16H24N2/c1-7-9-16(13(5)8-2)17-14(6)15-10-18(11-15)12(3)4/h7-9,12,15H,2,5-6,10-11H2,1,3-4H3/b9-7-,17-16-.
What are the key properties of (5Z)-3-methylidene-N-[1-(1-propan-2-ylazetidin-3-yl)ethenyl]hepta-1,5-dien-4-imine?
(5Z)-3-methylidene-N-[1-(1-propan-2-ylazetidin-3-yl)ethenyl]hepta-1,5-dien-4-imine has a molecular weight of 244.38 g/mol, XLogP of 3.60, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-3-methylidene-N-[1-(1-propan-2-ylazetidin-3-yl)ethenyl]hepta-1,5-dien-4-imine is sourced from PubChem (CID 144758061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).