C14H20N2 — CID 157043458
(6Z)-4-(azetidin-1-yl)-6-butan-2-ylidene-N-methylcyclohexa-2,4-dien-1-imine (PubChem CID 157043458) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is (6Z)-4-(azetidin-1-yl)-6-butan-2-ylidene-N-methylcyclohexa-2,4-dien-1-imine.
| Compound Name | (6Z)-4-(azetidin-1-yl)-6-butan-2-ylidene-N-methylcyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 157043458 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (6Z)-4-(azetidin-1-yl)-6-butan-2-ylidene-N-methylcyclohexa-2,4-dien-1-imine |
| SMILES | CC/C(C)=C1/C=C(N2CCC2)C=C/C1=N\C |
| InChI | InChI=1S/C14H20N2/c1-4-11(2)13-10-12(16-8-5-9-16)6-7-14(13)15-3/h6-7,10H,4-5,8-9H2,1-3H3/b13-11-,15-14+ |
| InChIKey | NKYRCDSITLEBQX-UNVBMEDASA-N |
| XLogP | 2.94 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|