C13H18N2 — CID 144758059
(5Z)-N-[1-(azetidin-3-yl)ethenyl]-3-methylidenehepta-1,5-dien-4-imine (PubChem CID 144758059) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (5Z)-N-[1-(azetidin-3-yl)ethenyl]-3-methylidenehepta-1,5-dien-4-imine.
| Compound Name | (5Z)-N-[1-(azetidin-3-yl)ethenyl]-3-methylidenehepta-1,5-dien-4-imine |
|---|---|
| PubChem CID | 144758059 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (5Z)-N-[1-(azetidin-3-yl)ethenyl]-3-methylidenehepta-1,5-dien-4-imine |
| SMILES | C=CC(=C)C(/C=C\C)=NC(=C)C1CNC1 |
| InChI | InChI=1S/C13H18N2/c1-5-7-13(10(3)6-2)15-11(4)12-8-14-9-12/h5-7,12,14H,2-4,8-9H2,1H3/b7-5-,15-13- |
| InChIKey | GSRIJSJNVKCECY-PGGAFRPESA-N |
| XLogP | 2.48 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|