C13H18N2 — CID 15204755
10-propan-2-yl-2,6-diazabicyclo[5.5.0]dodeca-1,7,9,11-tetraene (PubChem CID 15204755) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 10-propan-2-yl-2,6-diazabicyclo[5.5.0]dodeca-1,7,9,11-tetraene.
| Compound Name | 10-propan-2-yl-2,6-diazabicyclo[5.5.0]dodeca-1,7,9,11-tetraene |
|---|---|
| PubChem CID | 15204755 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 10-propan-2-yl-2,6-diazabicyclo[5.5.0]dodeca-1,7,9,11-tetraene |
| SMILES | CC(C)C1=CC=C2NCCCN=C2C=C1 |
| InChI | InChI=1S/C13H18N2/c1-10(2)11-4-6-12-13(7-5-11)15-9-3-8-14-12/h4-7,10,14H,3,8-9H2,1-2H3 |
| InChIKey | UULZMLMZZGEKCP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'colchicine_A(3)', 'substructure': 'N/A'} |
|---|