C14H18N2 — CID 156744172
1-(3-buta-1,3-dien-2-yl-4,5-dihydro-1H-azepin-2-yl)-N-methylprop-2-en-1-imine (PubChem CID 156744172) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-(3-buta-1,3-dien-2-yl-4,5-dihydro-1H-azepin-2-yl)-N-methylprop-2-en-1-imine.
| Compound Name | 1-(3-buta-1,3-dien-2-yl-4,5-dihydro-1H-azepin-2-yl)-N-methylprop-2-en-1-imine |
|---|---|
| PubChem CID | 156744172 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 1-(3-buta-1,3-dien-2-yl-4,5-dihydro-1H-azepin-2-yl)-N-methylprop-2-en-1-imine |
| SMILES | C=CC(=C)C1=C(/C(C=C)=N/C)NC=CCC1 |
| InChI | InChI=1S/C14H18N2/c1-5-11(3)12-9-7-8-10-16-14(12)13(6-2)15-4/h5-6,8,10,16H,1-3,7,9H2,4H3/b15-13+ |
| InChIKey | KYIYTPSGODGGGC-FYWRMAATSA-N |
| XLogP | 3.14 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|