C19H24N2O4S2 — CID 144758762
(2Z,4E)-N-[(2,4-dimethoxyphenyl)methyl]-N-(1,3-thiazol-2-yl)hepta-2,4-diene-4-sulfonamide (PubChem CID 144758762) has the molecular formula C19H24N2O4S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is (2Z,4E)-N-[(2,4-dimethoxyphenyl)methyl]-N-(1,3-thiazol-2-yl)hepta-2,4-diene-4-sulfonamide.
| Compound Name | (2Z,4E)-N-[(2,4-dimethoxyphenyl)methyl]-N-(1,3-thiazol-2-yl)hepta-2,4-diene-4-sulfonamide |
|---|---|
| PubChem CID | 144758762 |
| Molecular Formula | C19H24N2O4S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | (2Z,4E)-N-[(2,4-dimethoxyphenyl)methyl]-N-(1,3-thiazol-2-yl)hepta-2,4-diene-4-sulfonamide |
| SMILES | C/C=C\C(=C/CC)S(=O)(=O)N(Cc1ccc(OC)cc1OC)c1nccs1 |
| InChI | InChI=1S/C19H24N2O4S2/c1-5-7-17(8-6-2)27(22,23)21(19-20-11-12-26-19)14-15-9-10-16(24-3)13-18(15)25-4/h5,7-13H,6,14H2,1-4H3/b7-5-,17-8+ |
| InChIKey | YDJAJBSMQMNAMB-DJZAMEBTSA-N |
| XLogP | 4.37 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|