C29H23F4N3O8S3 — CID 86687674
[6-[(2,4-dimethoxyphenyl)methyl-(1,3-thiazol-2-yl)sulfamoyl]-1-(4-fluoro-2-methoxyphenyl)isoquinolin-4-yl] trifluoromethanesulfonate (PubChem CID 86687674) has the molecular formula C29H23F4N3O8S3 and a molecular weight of 713.71 g/mol. Its IUPAC name is [6-[(2,4-dimethoxyphenyl)methyl-(1,3-thiazol-2-yl)sulfamoyl]-1-(4-fluoro-2-methoxyphenyl)isoquinolin-4-yl] trifluoromethanesulfonate.
| Compound Name | [6-[(2,4-dimethoxyphenyl)methyl-(1,3-thiazol-2-yl)sulfamoyl]-1-(4-fluoro-2-methoxyphenyl)isoquinolin-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86687674 |
| Molecular Formula | C29H23F4N3O8S3 |
| Molecular Weight | 713.71 g/mol |
| Exact Mass | 713.06 |
| IUPAC Name | [6-[(2,4-dimethoxyphenyl)methyl-(1,3-thiazol-2-yl)sulfamoyl]-1-(4-fluoro-2-methoxyphenyl)isoquinolin-4-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(CN(c2nccs2)S(=O)(=O)c2ccc3c(-c4ccc(F)cc4OC)ncc(OS(=O)(=O)C(F)(F)F)c3c2)c(OC)c1 |
| InChI | InChI=1S/C29H23F4N3O8S3/c1-41-19-6-4-17(24(13-19)42-2)16-36(28-34-10-11-45-28)46(37,38)20-7-9-21-23(14-20)26(44-47(39,40)29(31,32)33)15-35-27(21)22-8-5-18(30)12-25(22)43-3/h4-15H,16H2,1-3H3 |
| InChIKey | XJRSCIPHGKLPDQ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 134.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.71 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|