C19H17FN2O6S2 — CID 145483733
methyl 2-fluoro-4-[(2-hydroxy-4-methoxyphenyl)methyl-(1,3-thiazol-2-yl)sulfamoyl]benzoate (PubChem CID 145483733) has the molecular formula C19H17FN2O6S2 and a molecular weight of 452.49 g/mol. Its IUPAC name is methyl 2-fluoro-4-[(2-hydroxy-4-methoxyphenyl)methyl-(1,3-thiazol-2-yl)sulfamoyl]benzoate.
| Compound Name | methyl 2-fluoro-4-[(2-hydroxy-4-methoxyphenyl)methyl-(1,3-thiazol-2-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 145483733 |
| Molecular Formula | C19H17FN2O6S2 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | methyl 2-fluoro-4-[(2-hydroxy-4-methoxyphenyl)methyl-(1,3-thiazol-2-yl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N(Cc2ccc(OC)cc2O)c2nccs2)cc1F |
| InChI | InChI=1S/C19H17FN2O6S2/c1-27-13-4-3-12(17(23)9-13)11-22(19-21-7-8-29-19)30(25,26)14-5-6-15(16(20)10-14)18(24)28-2/h3-10,23H,11H2,1-2H3 |
| InChIKey | VBCCOWQRQCYPIP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|