C19H17ClFN2O6S2+ — CID 145483628
[2-[[(5-chloro-1,3-thiazol-2-yl)-(3-fluoro-4-methoxycarbonylphenyl)sulfonylamino]methyl]-5-methoxyphenyl]oxidanium (PubChem CID 145483628) has the molecular formula C19H17ClFN2O6S2+ and a molecular weight of 487.94 g/mol. Its IUPAC name is [2-[[(5-chloro-1,3-thiazol-2-yl)-(3-fluoro-4-methoxycarbonylphenyl)sulfonylamino]methyl]-5-methoxyphenyl]oxidanium.
| Compound Name | [2-[[(5-chloro-1,3-thiazol-2-yl)-(3-fluoro-4-methoxycarbonylphenyl)sulfonylamino]methyl]-5-methoxyphenyl]oxidanium |
|---|---|
| PubChem CID | 145483628 |
| Molecular Formula | C19H17ClFN2O6S2+ |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | [2-[[(5-chloro-1,3-thiazol-2-yl)-(3-fluoro-4-methoxycarbonylphenyl)sulfonylamino]methyl]-5-methoxyphenyl]oxidanium |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N(Cc2ccc(OC)cc2[OH2+])c2ncc(Cl)s2)cc1F |
| InChI | InChI=1S/C19H16ClFN2O6S2/c1-28-12-4-3-11(16(24)7-12)10-23(19-22-9-17(20)30-19)31(26,27)13-5-6-14(15(21)8-13)18(25)29-2/h3-9,24H,10H2,1-2H3/p+1 |
| InChIKey | DBATZPKSYKEYID-UHFFFAOYSA-O |
| XLogP | 3.56 |
| TPSA | 108.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|