C6H12NO2+ — CID 144760033
2,2-dimethylmorpholin-4-ium-3-one (PubChem CID 144760033) has the molecular formula C6H12NO2+ and a molecular weight of 130.17 g/mol. Its IUPAC name is 2,2-dimethylmorpholin-4-ium-3-one.
| Compound Name | 2,2-dimethylmorpholin-4-ium-3-one |
|---|---|
| PubChem CID | 144760033 |
| Molecular Formula | C6H12NO2+ |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | 2,2-dimethylmorpholin-4-ium-3-one |
| SMILES | CC1(C)OCC[NH2+]C1=O |
| InChI | InChI=1S/C6H11NO2/c1-6(2)5(8)7-3-4-9-6/h3-4H2,1-2H3,(H,7,8)/p+1 |
| InChIKey | XWWFCUIIFIMRQE-UHFFFAOYSA-O |
| XLogP | -1.11 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |