C18H26N4O2S2 — CID 144760842
2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-4-carboxamide;ethane;methylamino N-ethylmethanimidothioate (PubChem CID 144760842) has the molecular formula C18H26N4O2S2 and a molecular weight of 394.57 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-4-carboxamide;ethane;methylamino N-ethylmethanimidothioate.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-4-carboxamide;ethane;methylamino N-ethylmethanimidothioate |
|---|---|
| PubChem CID | 144760842 |
| Molecular Formula | C18H26N4O2S2 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-4-carboxamide;ethane;methylamino N-ethylmethanimidothioate |
| SMILES | CC.CC/N=C/SNC.NC(=O)c1csc(-c2ccc3c(c2)CCO3)n1 |
| InChI | InChI=1S/C12H10N2O2S.C4H10N2S.C2H6/c13-11(15)9-6-17-12(14-9)8-1-2-10-7(5-8)3-4-16-10;1-3-6-4-7-5-2;1-2/h1-2,5-6H,3-4H2,(H2,13,15);4-5H,3H2,1-2H3;1-2H3/b;6-4+; |
| InChIKey | CEVOWCKKUSTKRA-HWWUXOKASA-N |
| XLogP | 3.77 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|