C12H15NaO5 — CID 144761323
sodium 2-(1,1,3-trimethoxy-3-oxopropan-2-yl)phenolate (PubChem CID 144761323) has the molecular formula C12H15NaO5 and a molecular weight of 262.24 g/mol. Its IUPAC name is sodium 2-(1,1,3-trimethoxy-3-oxopropan-2-yl)phenolate.
| Compound Name | sodium 2-(1,1,3-trimethoxy-3-oxopropan-2-yl)phenolate |
|---|---|
| PubChem CID | 144761323 |
| Molecular Formula | C12H15NaO5 |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | sodium 2-(1,1,3-trimethoxy-3-oxopropan-2-yl)phenolate |
| SMILES | COC(=O)C(c1ccccc1[O-])C(OC)OC.[Na+] |
| InChI | InChI=1S/C12H16O5.Na/c1-15-11(14)10(12(16-2)17-3)8-6-4-5-7-9(8)13;/h4-7,10,12-13H,1-3H3;/q;+1/p-1 |
| InChIKey | FSOZXWOIQKEOGR-UHFFFAOYSA-M |
| XLogP | -2.36 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|