C22H23N3O — CID 144762807
2-ethanimidoyl-4-[4-(3-phenylpropoxy)-2-pyridinyl]aniline (PubChem CID 144762807) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is 2-ethanimidoyl-4-[4-(3-phenylpropoxy)-2-pyridinyl]aniline.
| Compound Name | 2-ethanimidoyl-4-[4-(3-phenylpropoxy)-2-pyridinyl]aniline |
|---|---|
| PubChem CID | 144762807 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 2-ethanimidoyl-4-[4-(3-phenylpropoxy)-2-pyridinyl]aniline |
| SMILES | [H]/N=C(\C)c1cc(-c2cc(OCCCc3ccccc3)ccn2)ccc1N |
| InChI | InChI=1S/C22H23N3O/c1-16(23)20-14-18(9-10-21(20)24)22-15-19(11-12-25-22)26-13-5-8-17-6-3-2-4-7-17/h2-4,6-7,9-12,14-15,23H,5,8,13,24H2,1H3/b23-16+ |
| InChIKey | MDDFJWGOMZTLKD-XQNSMLJCSA-N |
| XLogP | 4.73 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|