C18H18N6 — CID 162531322
2-amino-5-[2-(benzylamino)pyrimidin-5-yl]benzenecarboximidamide (PubChem CID 162531322) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-amino-5-[2-(benzylamino)pyrimidin-5-yl]benzenecarboximidamide.
| Compound Name | 2-amino-5-[2-(benzylamino)pyrimidin-5-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 162531322 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-amino-5-[2-(benzylamino)pyrimidin-5-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(-c2cnc(NCc3ccccc3)nc2)ccc1N |
| InChI | InChI=1S/C18H18N6/c19-16-7-6-13(8-15(16)17(20)21)14-10-23-18(24-11-14)22-9-12-4-2-1-3-5-12/h1-8,10-11H,9,19H2,(H3,20,21)(H,22,23,24) |
| InChIKey | VIUFWQYPRFAJJY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|