C18H18N4 — CID 142077126
4-N-benzyl-2-(1H-pyrrole-2-carboximidoyl)benzene-1,4-diamine (PubChem CID 142077126) has the molecular formula C18H18N4 and a molecular weight of 290.37 g/mol. Its IUPAC name is 4-N-benzyl-2-(1H-pyrrole-2-carboximidoyl)benzene-1,4-diamine.
| Compound Name | 4-N-benzyl-2-(1H-pyrrole-2-carboximidoyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 142077126 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4-N-benzyl-2-(1H-pyrrole-2-carboximidoyl)benzene-1,4-diamine |
| SMILES | [H]/N=C(\c1ccc[nH]1)c1cc(NCc2ccccc2)ccc1N |
| InChI | InChI=1S/C18H18N4/c19-16-9-8-14(22-12-13-5-2-1-3-6-13)11-15(16)18(20)17-7-4-10-21-17/h1-11,20-22H,12,19H2/b20-18- |
| InChIKey | UYVVKKNVLSHGDS-ZZEZOPTASA-N |
| XLogP | 3.63 |
| TPSA | 77.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|