About 6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione
6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione (PubChem CID 144763345) has the molecular formula C14H12N4O3
and a molecular weight of 284.28 g/mol. Its IUPAC name is 6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione |
| PubChem CID | 144763345 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(NCc2ccccc2)[nH]c(=O)n1-c1ccon1 |
| InChI | InChI=1S/C14H12N4O3/c19-13-8-11(15-9-10-4-2-1-3-5-10)16-14(20)18(13)12-6-7-21-17-12/h1-8,15H,9H2,(H,16,20) |
| InChIKey | SOPHGAJDDMEXLP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione?
The IUPAC name of 6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione (CID 144763345) is 6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione?
The canonical SMILES for 6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione is O=c1cc(NCc2ccccc2)[nH]c(=O)n1-c1ccon1.
What is the InChIKey of 6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione?
The InChIKey is SOPHGAJDDMEXLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O3/c19-13-8-11(15-9-10-4-2-1-3-5-10)16-14(20)18(13)12-6-7-21-17-12/h1-8,15H,9H2,(H,16,20).
What are the key properties of 6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione?
6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione has a molecular weight of 284.28 g/mol, XLogP of 1.13, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 144763345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).