C14H12N4O3 — CID 144763345
6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione (PubChem CID 144763345) has the molecular formula C14H12N4O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is 6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 144763345 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 6-(benzylamino)-3-(1,2-oxazol-3-yl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(NCc2ccccc2)[nH]c(=O)n1-c1ccon1 |
| InChI | InChI=1S/C14H12N4O3/c19-13-8-11(15-9-10-4-2-1-3-5-10)16-14(20)18(13)12-6-7-21-17-12/h1-8,15H,9H2,(H,16,20) |
| InChIKey | SOPHGAJDDMEXLP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |