C20H17ClF3N5O — CID 144763531
(Z)-2-(6-chloro-3-pyridinyl)-3-[3-[3-propyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide (PubChem CID 144763531) has the molecular formula C20H17ClF3N5O and a molecular weight of 435.84 g/mol. Its IUPAC name is (Z)-2-(6-chloro-3-pyridinyl)-3-[3-[3-propyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide.
| Compound Name | (Z)-2-(6-chloro-3-pyridinyl)-3-[3-[3-propyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 144763531 |
| Molecular Formula | C20H17ClF3N5O |
| Molecular Weight | 435.84 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (Z)-2-(6-chloro-3-pyridinyl)-3-[3-[3-propyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide |
| SMILES | CCCc1cc(-c2ncn(/C=C(\C(N)=O)c3ccc(Cl)nc3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17ClF3N5O/c1-2-3-12-6-14(8-15(7-12)20(22,23)24)19-27-11-29(28-19)10-16(18(25)30)13-4-5-17(21)26-9-13/h4-11H,2-3H2,1H3,(H2,25,30)/b16-10- |
| InChIKey | BXIIIQXTAQSUAR-YBEGLDIGSA-N |
| XLogP | 4.45 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.84 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|