C24H26N4O — CID 144764924
5-[[2-[4-(dimethylamino)phenyl]-1-methylpyrrolo[3,2-c]pyridin-4-yl]amino]-2-ethylphenol (PubChem CID 144764924) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is 5-[[2-[4-(dimethylamino)phenyl]-1-methylpyrrolo[3,2-c]pyridin-4-yl]amino]-2-ethylphenol.
| Compound Name | 5-[[2-[4-(dimethylamino)phenyl]-1-methylpyrrolo[3,2-c]pyridin-4-yl]amino]-2-ethylphenol |
|---|---|
| PubChem CID | 144764924 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 5-[[2-[4-(dimethylamino)phenyl]-1-methylpyrrolo[3,2-c]pyridin-4-yl]amino]-2-ethylphenol |
| SMILES | CCc1ccc(Nc2nccc3c2cc(-c2ccc(N(C)C)cc2)n3C)cc1O |
| InChI | InChI=1S/C24H26N4O/c1-5-16-6-9-18(14-23(16)29)26-24-20-15-22(28(4)21(20)12-13-25-24)17-7-10-19(11-8-17)27(2)3/h6-15,29H,5H2,1-4H3,(H,25,26) |
| InChIKey | KFKYZAJADFDPAY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|