C25H33N3O2 — CID 144765836
N-[(1R)-1-cyclohexyl-2-oxo-2-(3-pyridin-2-ylpropylamino)ethyl]-3,4-dimethylbenzamide (PubChem CID 144765836) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[(1R)-1-cyclohexyl-2-oxo-2-(3-pyridin-2-ylpropylamino)ethyl]-3,4-dimethylbenzamide.
| Compound Name | N-[(1R)-1-cyclohexyl-2-oxo-2-(3-pyridin-2-ylpropylamino)ethyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 144765836 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-[(1R)-1-cyclohexyl-2-oxo-2-(3-pyridin-2-ylpropylamino)ethyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H](C(=O)NCCCc2ccccn2)C2CCCCC2)cc1C |
| InChI | InChI=1S/C25H33N3O2/c1-18-13-14-21(17-19(18)2)24(29)28-23(20-9-4-3-5-10-20)25(30)27-16-8-12-22-11-6-7-15-26-22/h6-7,11,13-15,17,20,23H,3-5,8-10,12,16H2,1-2H3,(H,27,30)(H,28,29)/t23-/m1/s1 |
| InChIKey | AEOAFSDHIBPBMA-HSZRJFAPSA-N |
| XLogP | 4.13 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|