C14H18 — CID 144766027
2-ethenyl-1,1,3-trimethyl-5,6-dihydroindene (PubChem CID 144766027) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-ethenyl-1,1,3-trimethyl-5,6-dihydroindene.
| Compound Name | 2-ethenyl-1,1,3-trimethyl-5,6-dihydroindene |
|---|---|
| PubChem CID | 144766027 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-ethenyl-1,1,3-trimethyl-5,6-dihydroindene |
| SMILES | C=CC1=C(C)C2=CCCC=C2C1(C)C |
| InChI | InChI=1S/C14H18/c1-5-12-10(2)11-8-6-7-9-13(11)14(12,3)4/h5,8-9H,1,6-7H2,2-4H3 |
| InChIKey | LWXUICCWZUJXKR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |