C45H36N6 — CID 144768267
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-bis(4-phenylphenyl)pyrimidin-5-amine;ethane (PubChem CID 144768267) has the molecular formula C45H36N6 and a molecular weight of 660.83 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-bis(4-phenylphenyl)pyrimidin-5-amine;ethane.
| Compound Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-bis(4-phenylphenyl)pyrimidin-5-amine;ethane |
|---|---|
| PubChem CID | 144768267 |
| Molecular Formula | C45H36N6 |
| Molecular Weight | 660.83 g/mol |
| Exact Mass | 660.30 |
| IUPAC Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-bis(4-phenylphenyl)pyrimidin-5-amine;ethane |
| SMILES | CC.c1ccc(-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3cnc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)nc3)cc2)cc1 |
| InChI | InChI=1S/C43H30N6.C2H6/c1-5-13-31(14-6-1)33-21-25-37(26-22-33)49(38-27-23-34(24-28-38)32-15-7-2-8-16-32)39-29-44-42(45-30-39)43-47-40(35-17-9-3-10-18-35)46-41(48-43)36-19-11-4-12-20-36;1-2/h1-30H;1-2H3 |
| InChIKey | YJDREQDEYCRNSF-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 67.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.83 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |