C18H21NO3 — CID 144772769
2-aminoethyl 4-(4-cyclohexa-1,5-dien-1-ylphenyl)-4-oxobutanoate (PubChem CID 144772769) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-aminoethyl 4-(4-cyclohexa-1,5-dien-1-ylphenyl)-4-oxobutanoate.
| Compound Name | 2-aminoethyl 4-(4-cyclohexa-1,5-dien-1-ylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 144772769 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-aminoethyl 4-(4-cyclohexa-1,5-dien-1-ylphenyl)-4-oxobutanoate |
| SMILES | NCCOC(=O)CCC(=O)c1ccc(C2=CCCC=C2)cc1 |
| InChI | InChI=1S/C18H21NO3/c19-12-13-22-18(21)11-10-17(20)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h2,4-9H,1,3,10-13,19H2 |
| InChIKey | JTALHNURNFUNSD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |