C16H15Cl2NO2 — CID 144772940
[3-chloro-2-[[(3E,5E)-6-chloro-3-methylhepta-1,3,5-trien-4-yl]oxymethyl]phenyl] cyanate (PubChem CID 144772940) has the molecular formula C16H15Cl2NO2 and a molecular weight of 324.21 g/mol. Its IUPAC name is [3-chloro-2-[[(3E,5E)-6-chloro-3-methylhepta-1,3,5-trien-4-yl]oxymethyl]phenyl] cyanate.
| Compound Name | [3-chloro-2-[[(3E,5E)-6-chloro-3-methylhepta-1,3,5-trien-4-yl]oxymethyl]phenyl] cyanate |
|---|---|
| PubChem CID | 144772940 |
| Molecular Formula | C16H15Cl2NO2 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | [3-chloro-2-[[(3E,5E)-6-chloro-3-methylhepta-1,3,5-trien-4-yl]oxymethyl]phenyl] cyanate |
| SMILES | C=C/C(C)=C(\C=C(/C)Cl)OCc1c(Cl)cccc1OC#N |
| InChI | InChI=1S/C16H15Cl2NO2/c1-4-11(2)16(8-12(3)17)20-9-13-14(18)6-5-7-15(13)21-10-19/h4-8H,1,9H2,2-3H3/b12-8+,16-11+ |
| InChIKey | KFYAOUKRVLCOGP-VVROIFTPSA-N |
| XLogP | 5.32 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|