C20H18ClNO — CID 154647227
[5-[(1E)-3-(3-chloro-2-methylphenyl)buta-1,3-dienyl]-2-ethylphenyl] cyanate (PubChem CID 154647227) has the molecular formula C20H18ClNO and a molecular weight of 323.82 g/mol. Its IUPAC name is [5-[(1E)-3-(3-chloro-2-methylphenyl)buta-1,3-dienyl]-2-ethylphenyl] cyanate.
| Compound Name | [5-[(1E)-3-(3-chloro-2-methylphenyl)buta-1,3-dienyl]-2-ethylphenyl] cyanate |
|---|---|
| PubChem CID | 154647227 |
| Molecular Formula | C20H18ClNO |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | [5-[(1E)-3-(3-chloro-2-methylphenyl)buta-1,3-dienyl]-2-ethylphenyl] cyanate |
| SMILES | C=C(/C=C/c1ccc(CC)c(OC#N)c1)c1cccc(Cl)c1C |
| InChI | InChI=1S/C20H18ClNO/c1-4-17-11-10-16(12-20(17)23-13-22)9-8-14(2)18-6-5-7-19(21)15(18)3/h5-12H,2,4H2,1,3H3/b9-8+ |
| InChIKey | QLOCOUNUABIGLU-CMDGGOBGSA-N |
| XLogP | 5.80 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|