C20H19Cl2N3O — CID 144773253
1-[2-[(2,5-dichloro-4-pyridin-2-ylphenoxy)methyl]-3-methylphenyl]-1-methylhydrazine (PubChem CID 144773253) has the molecular formula C20H19Cl2N3O and a molecular weight of 388.30 g/mol. Its IUPAC name is 1-[2-[(2,5-dichloro-4-pyridin-2-ylphenoxy)methyl]-3-methylphenyl]-1-methylhydrazine.
| Compound Name | 1-[2-[(2,5-dichloro-4-pyridin-2-ylphenoxy)methyl]-3-methylphenyl]-1-methylhydrazine |
|---|---|
| PubChem CID | 144773253 |
| Molecular Formula | C20H19Cl2N3O |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 1-[2-[(2,5-dichloro-4-pyridin-2-ylphenoxy)methyl]-3-methylphenyl]-1-methylhydrazine |
| SMILES | Cc1cccc(N(C)N)c1COc1cc(Cl)c(-c2ccccn2)cc1Cl |
| InChI | InChI=1S/C20H19Cl2N3O/c1-13-6-5-8-19(25(2)23)15(13)12-26-20-11-16(21)14(10-17(20)22)18-7-3-4-9-24-18/h3-11H,12,23H2,1-2H3 |
| InChIKey | PFLRPEVIQQZKNC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|