C19H27IN2O — CID 144774513
1-[1-[4-(dimethylamino)phenyl]-4,4-dimethyl-2,3-dihydropyridin-5-yl]-2-iodo-2-methylpropan-1-one (PubChem CID 144774513) has the molecular formula C19H27IN2O and a molecular weight of 426.34 g/mol. Its IUPAC name is 1-[1-[4-(dimethylamino)phenyl]-4,4-dimethyl-2,3-dihydropyridin-5-yl]-2-iodo-2-methylpropan-1-one.
| Compound Name | 1-[1-[4-(dimethylamino)phenyl]-4,4-dimethyl-2,3-dihydropyridin-5-yl]-2-iodo-2-methylpropan-1-one |
|---|---|
| PubChem CID | 144774513 |
| Molecular Formula | C19H27IN2O |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 1-[1-[4-(dimethylamino)phenyl]-4,4-dimethyl-2,3-dihydropyridin-5-yl]-2-iodo-2-methylpropan-1-one |
| SMILES | CN(C)c1ccc(N2C=C(C(=O)C(C)(C)I)C(C)(C)CC2)cc1 |
| InChI | InChI=1S/C19H27IN2O/c1-18(2)11-12-22(13-16(18)17(23)19(3,4)20)15-9-7-14(8-10-15)21(5)6/h7-10,13H,11-12H2,1-6H3 |
| InChIKey | HRYKVVXEAYMNLZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|