About CID 144774618
CID 144774618 (PubChem CID 144774618) has the molecular formula C27H39NO2
and a molecular weight of 409.61 g/mol.
Molecular Properties
| Compound Name | CID 144774618 |
| PubChem CID | 144774618 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | — |
| SMILES | CCCNCc1ccccc1.C[C@@H]1C(=O)O[C@@H]2C3C(CCC34CC4)C3(CC[C@@H]12)CC3 |
| InChI | InChI=1S/C17H24O2.C10H15N/c1-10-11-2-4-16(6-7-16)12-3-5-17(8-9-17)13(12)14(11)19-15(10)18;1-2-8-11-9-10-6-4-3-5-7-10/h10-14H,2-9H2,1H3;3-7,11H,2,8-9H2,1H3/t10-,11-,12?,13?,14-;/m0./s1 |
| InChIKey | NDLSMNKSRVLKDP-UNKPOBRLSA-N |
| XLogP | 5.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 144774618 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144774618?
The IUPAC name of CID 144774618 (CID 144774618) is not available.
What is the SMILES notation for CID 144774618?
The canonical SMILES for CID 144774618 is CCCNCc1ccccc1.C[C@@H]1C(=O)O[C@@H]2C3C(CCC34CC4)C3(CC[C@@H]12)CC3.
What is the InChIKey of CID 144774618?
The InChIKey is NDLSMNKSRVLKDP-UNKPOBRLSA-N. The full InChI is InChI=1S/C17H24O2.C10H15N/c1-10-11-2-4-16(6-7-16)12-3-5-17(8-9-17)13(12)14(11)19-15(10)18;1-2-8-11-9-10-6-4-3-5-7-10/h10-14H,2-9H2,1H3;3-7,11H,2,8-9H2,1H3/t10-,11-,12?,13?,14-;/m0./s1.
What are the key properties of CID 144774618?
CID 144774618 has a molecular weight of 409.61 g/mol, XLogP of 5.73, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144774618 is sourced from PubChem (CID 144774618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).