C31H26F6N2O4 — CID 144775356
2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-propan-2-ylphenyl)propan-2-yl]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone;propane (PubChem CID 144775356) has the molecular formula C31H26F6N2O4 and a molecular weight of 604.55 g/mol. Its IUPAC name is 2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-propan-2-ylphenyl)propan-2-yl]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone;propane.
| Compound Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-propan-2-ylphenyl)propan-2-yl]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone;propane |
|---|---|
| PubChem CID | 144775356 |
| Molecular Formula | C31H26F6N2O4 |
| Molecular Weight | 604.55 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-propan-2-ylphenyl)propan-2-yl]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone;propane |
| SMILES | CC(C)c1ccc(C(c2ccc(-n3c(=O)c4cc5c(=O)[nH]c(=O)c5cc4c3=O)cc2)(C(F)(F)F)C(F)(F)F)cc1.CCC |
| InChI | InChI=1S/C28H18F6N2O4.C3H8/c1-13(2)14-3-5-15(6-4-14)26(27(29,30)31,28(32,33)34)16-7-9-17(10-8-16)36-24(39)20-11-18-19(12-21(20)25(36)40)23(38)35-22(18)37;1-3-2/h3-13H,1-2H3,(H,35,37,38);3H2,1-2H3 |
| InChIKey | DPMCHRJQJLPMGI-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |