C25H34O — CID 144776150
1-[3-[2-(3,5-ditert-butylphenyl)ethyl]-2-methylphenyl]ethanone (PubChem CID 144776150) has the molecular formula C25H34O and a molecular weight of 350.55 g/mol. Its IUPAC name is 1-[3-[2-(3,5-ditert-butylphenyl)ethyl]-2-methylphenyl]ethanone.
| Compound Name | 1-[3-[2-(3,5-ditert-butylphenyl)ethyl]-2-methylphenyl]ethanone |
|---|---|
| PubChem CID | 144776150 |
| Molecular Formula | C25H34O |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | 1-[3-[2-(3,5-ditert-butylphenyl)ethyl]-2-methylphenyl]ethanone |
| SMILES | CC(=O)c1cccc(CCc2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1C |
| InChI | InChI=1S/C25H34O/c1-17-20(10-9-11-23(17)18(2)26)13-12-19-14-21(24(3,4)5)16-22(15-19)25(6,7)8/h9-11,14-16H,12-13H2,1-8H3 |
| InChIKey | GMZQZBLLKJOWFZ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |