C54H42N6 — CID 144777221
2-[2-[4-[2-(7,8-dihydrophenanthren-9-yl)-6-phenanthren-9-yl-1,4-dihydro-1,3,5-triazin-4-yl]phenyl]-4a,5-dihydroquinazolin-4-yl]-1-phenylprop-1-en-1-amine (PubChem CID 144777221) has the molecular formula C54H42N6 and a molecular weight of 774.97 g/mol. Its IUPAC name is 2-[2-[4-[2-(7,8-dihydrophenanthren-9-yl)-6-phenanthren-9-yl-1,4-dihydro-1,3,5-triazin-4-yl]phenyl]-4a,5-dihydroquinazolin-4-yl]-1-phenylprop-1-en-1-amine.
| Compound Name | 2-[2-[4-[2-(7,8-dihydrophenanthren-9-yl)-6-phenanthren-9-yl-1,4-dihydro-1,3,5-triazin-4-yl]phenyl]-4a,5-dihydroquinazolin-4-yl]-1-phenylprop-1-en-1-amine |
|---|---|
| PubChem CID | 144777221 |
| Molecular Formula | C54H42N6 |
| Molecular Weight | 774.97 g/mol |
| Exact Mass | 774.35 |
| IUPAC Name | 2-[2-[4-[2-(7,8-dihydrophenanthren-9-yl)-6-phenanthren-9-yl-1,4-dihydro-1,3,5-triazin-4-yl]phenyl]-4a,5-dihydroquinazolin-4-yl]-1-phenylprop-1-en-1-amine |
| SMILES | CC(C1=NC(c2ccc(C3N=C(c4cc5ccccc5c5c4CCC=C5)NC(c4cc5ccccc5c5ccccc45)=N3)cc2)=NC2=CC=CCC21)=C(N)c1ccccc1 |
| InChI | InChI=1S/C54H42N6/c1-33(49(55)34-15-3-2-4-16-34)50-45-25-13-14-26-48(45)56-51(57-50)35-27-29-36(30-28-35)52-58-53(46-31-37-17-5-7-19-39(37)41-21-9-11-23-43(41)46)60-54(59-52)47-32-38-18-6-8-20-40(38)42-22-10-12-24-44(42)47/h2-11,13-23,26-32,45,52H,12,24-25,55H2,1H3,(H,58,59,60) |
| InChIKey | HZAWLDNAUMWQBM-UHFFFAOYSA-N |
| XLogP | 11.65 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.97 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|