C54H56N4 — CID 144777447
4-(4-tert-butyl-N-[6-(4-tert-butyl-N-(4-cyanocyclohexa-1,3-dien-1-yl)anilino)pyren-1-yl]anilino)benzonitrile;ethane (PubChem CID 144777447) has the molecular formula C54H56N4 and a molecular weight of 761.07 g/mol. Its IUPAC name is 4-(4-tert-butyl-N-[6-(4-tert-butyl-N-(4-cyanocyclohexa-1,3-dien-1-yl)anilino)pyren-1-yl]anilino)benzonitrile;ethane.
| Compound Name | 4-(4-tert-butyl-N-[6-(4-tert-butyl-N-(4-cyanocyclohexa-1,3-dien-1-yl)anilino)pyren-1-yl]anilino)benzonitrile;ethane |
|---|---|
| PubChem CID | 144777447 |
| Molecular Formula | C54H56N4 |
| Molecular Weight | 761.07 g/mol |
| Exact Mass | 760.45 |
| IUPAC Name | 4-(4-tert-butyl-N-[6-(4-tert-butyl-N-(4-cyanocyclohexa-1,3-dien-1-yl)anilino)pyren-1-yl]anilino)benzonitrile;ethane |
| SMILES | CC.CC.CC(C)(C)c1ccc(N(C2=CC=C(C#N)CC2)c2ccc3ccc4c(N(c5ccc(C#N)cc5)c5ccc(C(C)(C)C)cc5)ccc5ccc2c3c54)cc1 |
| InChI | InChI=1S/C50H44N4.2C2H6/c1-49(2,3)37-15-23-41(24-16-37)53(39-19-7-33(31-51)8-20-39)45-29-13-35-12-28-44-46(30-14-36-11-27-43(45)47(35)48(36)44)54(40-21-9-34(32-52)10-22-40)42-25-17-38(18-26-42)50(4,5)6;2*1-2/h7-9,11-21,23-30H,10,22H2,1-6H3;2*1-2H3 |
| InChIKey | KVLNQDJYGKGPPV-UHFFFAOYSA-N |
| XLogP | 15.84 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.07 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|