C60H46N4 — CID 129074156
4-(N-[7-tert-butyl-3-(4-cyano-N-(2-methyl-5-phenylphenyl)anilino)pyren-1-yl]-2-methyl-5-phenylanilino)benzonitrile (PubChem CID 129074156) has the molecular formula C60H46N4 and a molecular weight of 823.06 g/mol. Its IUPAC name is 4-(N-[7-tert-butyl-3-(4-cyano-N-(2-methyl-5-phenylphenyl)anilino)pyren-1-yl]-2-methyl-5-phenylanilino)benzonitrile.
| Compound Name | 4-(N-[7-tert-butyl-3-(4-cyano-N-(2-methyl-5-phenylphenyl)anilino)pyren-1-yl]-2-methyl-5-phenylanilino)benzonitrile |
|---|---|
| PubChem CID | 129074156 |
| Molecular Formula | C60H46N4 |
| Molecular Weight | 823.06 g/mol |
| Exact Mass | 822.37 |
| IUPAC Name | 4-(N-[7-tert-butyl-3-(4-cyano-N-(2-methyl-5-phenylphenyl)anilino)pyren-1-yl]-2-methyl-5-phenylanilino)benzonitrile |
| SMILES | Cc1ccc(-c2ccccc2)cc1N(c1ccc(C#N)cc1)c1cc(N(c2ccc(C#N)cc2)c2cc(-c3ccccc3)ccc2C)c2ccc3cc(C(C)(C)C)cc4ccc1c2c43 |
| InChI | InChI=1S/C60H46N4/c1-39-16-22-45(43-12-8-6-9-13-43)34-54(39)63(50-26-18-41(37-61)19-27-50)56-36-57(53-31-25-48-33-49(60(3,4)5)32-47-24-30-52(56)59(53)58(47)48)64(51-28-20-42(38-62)21-29-51)55-35-46(23-17-40(55)2)44-14-10-7-11-15-44/h6-36H,1-5H3 |
| InChIKey | FEXBHABPUDWJNV-UHFFFAOYSA-N |
| XLogP | 16.52 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.06 |
| LogP ≤ 5 | 16.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|