C78H72N2 — CID 129062943
7-tert-butyl-1-N,3-N-bis(2-tert-butyl-5-phenylphenyl)-1-N,3-N-bis(2-methyl-5-phenylphenyl)pyrene-1,3-diamine (PubChem CID 129062943) has the molecular formula C78H72N2 and a molecular weight of 1037.45 g/mol. Its IUPAC name is 7-tert-butyl-1-N,3-N-bis(2-tert-butyl-5-phenylphenyl)-1-N,3-N-bis(2-methyl-5-phenylphenyl)pyrene-1,3-diamine.
| Compound Name | 7-tert-butyl-1-N,3-N-bis(2-tert-butyl-5-phenylphenyl)-1-N,3-N-bis(2-methyl-5-phenylphenyl)pyrene-1,3-diamine |
|---|---|
| PubChem CID | 129062943 |
| Molecular Formula | C78H72N2 |
| Molecular Weight | 1037.45 g/mol |
| Exact Mass | 1036.57 |
| IUPAC Name | 7-tert-butyl-1-N,3-N-bis(2-tert-butyl-5-phenylphenyl)-1-N,3-N-bis(2-methyl-5-phenylphenyl)pyrene-1,3-diamine |
| SMILES | Cc1ccc(-c2ccccc2)cc1N(c1cc(-c2ccccc2)ccc1C(C)(C)C)c1cc(N(c2cc(-c3ccccc3)ccc2C)c2cc(-c3ccccc3)ccc2C(C)(C)C)c2ccc3cc(C(C)(C)C)cc4ccc1c2c43 |
| InChI | InChI=1S/C78H72N2/c1-51-32-34-57(53-24-16-12-17-25-53)46-68(51)79(72-48-59(55-28-20-14-21-29-55)38-42-66(72)77(6,7)8)70-50-71(65-41-37-62-45-63(76(3,4)5)44-61-36-40-64(70)75(65)74(61)62)80(69-47-58(35-33-52(69)2)54-26-18-13-19-27-54)73-49-60(56-30-22-15-23-31-56)39-43-67(73)78(9,10)11/h12-50H,1-11H3 |
| InChIKey | RQSVWTCHKMKKGW-UHFFFAOYSA-N |
| XLogP | 22.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1037.45 |
| LogP ≤ 5 | 22.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|