C62H50N4 — CID 129074143
4-[3-(N-[7-tert-butyl-3-(N-[5-(4-cyanophenyl)-2-methylphenyl]-2-methylanilino)pyren-1-yl]-2-methylanilino)-4-methylphenyl]benzonitrile (PubChem CID 129074143) has the molecular formula C62H50N4 and a molecular weight of 851.11 g/mol. Its IUPAC name is 4-[3-(N-[7-tert-butyl-3-(N-[5-(4-cyanophenyl)-2-methylphenyl]-2-methylanilino)pyren-1-yl]-2-methylanilino)-4-methylphenyl]benzonitrile.
| Compound Name | 4-[3-(N-[7-tert-butyl-3-(N-[5-(4-cyanophenyl)-2-methylphenyl]-2-methylanilino)pyren-1-yl]-2-methylanilino)-4-methylphenyl]benzonitrile |
|---|---|
| PubChem CID | 129074143 |
| Molecular Formula | C62H50N4 |
| Molecular Weight | 851.11 g/mol |
| Exact Mass | 850.40 |
| IUPAC Name | 4-[3-(N-[7-tert-butyl-3-(N-[5-(4-cyanophenyl)-2-methylphenyl]-2-methylanilino)pyren-1-yl]-2-methylanilino)-4-methylphenyl]benzonitrile |
| SMILES | Cc1ccccc1N(c1cc(-c2ccc(C#N)cc2)ccc1C)c1cc(N(c2ccccc2C)c2cc(-c3ccc(C#N)cc3)ccc2C)c2ccc3cc(C(C)(C)C)cc4ccc1c2c43 |
| InChI | InChI=1S/C62H50N4/c1-39-12-8-10-14-54(39)65(56-34-47(22-16-41(56)3)45-24-18-43(37-63)19-25-45)58-36-59(53-31-29-50-33-51(62(5,6)7)32-49-28-30-52(58)61(53)60(49)50)66(55-15-11-9-13-40(55)2)57-35-48(23-17-42(57)4)46-26-20-44(38-64)21-27-46/h8-36H,1-7H3 |
| InChIKey | DMGXPIGHQYZKFD-UHFFFAOYSA-N |
| XLogP | 17.13 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.11 |
| LogP ≤ 5 | 17.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|