C66H64N2 — CID 129062939
7-tert-butyl-1-N,3-N-bis(2,5-dimethylphenyl)-1-N,3-N-bis[5-(2,6-dimethylphenyl)-2-methylphenyl]pyrene-1,3-diamine (PubChem CID 129062939) has the molecular formula C66H64N2 and a molecular weight of 885.25 g/mol. Its IUPAC name is 7-tert-butyl-1-N,3-N-bis(2,5-dimethylphenyl)-1-N,3-N-bis[5-(2,6-dimethylphenyl)-2-methylphenyl]pyrene-1,3-diamine.
| Compound Name | 7-tert-butyl-1-N,3-N-bis(2,5-dimethylphenyl)-1-N,3-N-bis[5-(2,6-dimethylphenyl)-2-methylphenyl]pyrene-1,3-diamine |
|---|---|
| PubChem CID | 129062939 |
| Molecular Formula | C66H64N2 |
| Molecular Weight | 885.25 g/mol |
| Exact Mass | 884.51 |
| IUPAC Name | 7-tert-butyl-1-N,3-N-bis(2,5-dimethylphenyl)-1-N,3-N-bis[5-(2,6-dimethylphenyl)-2-methylphenyl]pyrene-1,3-diamine |
| SMILES | Cc1ccc(C)c(N(c2cc(-c3c(C)cccc3C)ccc2C)c2cc(N(c3cc(C)ccc3C)c3cc(-c4c(C)cccc4C)ccc3C)c3ccc4cc(C(C)(C)C)cc5ccc2c3c54)c1 |
| InChI | InChI=1S/C66H64N2/c1-39-20-22-41(3)56(32-39)67(58-36-51(26-24-43(58)5)62-45(7)16-14-17-46(62)8)60-38-61(55-31-29-50-35-53(66(11,12)13)34-49-28-30-54(60)65(55)64(49)50)68(57-33-40(2)21-23-42(57)4)59-37-52(27-25-44(59)6)63-47(9)18-15-19-48(63)10/h14-38H,1-13H3 |
| InChIKey | YCGHLEVEVVPZRI-UHFFFAOYSA-N |
| XLogP | 19.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.25 |
| LogP ≤ 5 | 19.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|