C64H64N2Si2 — CID 140793577
7-tert-butyl-1-N,3-N-bis(2-methyl-5-phenylphenyl)-1-N,3-N-bis(3-trimethylsilylphenyl)pyrene-1,3-diamine (PubChem CID 140793577) has the molecular formula C64H64N2Si2 and a molecular weight of 917.40 g/mol. Its IUPAC name is 7-tert-butyl-1-N,3-N-bis(2-methyl-5-phenylphenyl)-1-N,3-N-bis(3-trimethylsilylphenyl)pyrene-1,3-diamine.
| Compound Name | 7-tert-butyl-1-N,3-N-bis(2-methyl-5-phenylphenyl)-1-N,3-N-bis(3-trimethylsilylphenyl)pyrene-1,3-diamine |
|---|---|
| PubChem CID | 140793577 |
| Molecular Formula | C64H64N2Si2 |
| Molecular Weight | 917.40 g/mol |
| Exact Mass | 916.46 |
| IUPAC Name | 7-tert-butyl-1-N,3-N-bis(2-methyl-5-phenylphenyl)-1-N,3-N-bis(3-trimethylsilylphenyl)pyrene-1,3-diamine |
| SMILES | Cc1ccc(-c2ccccc2)cc1N(c1cccc([Si](C)(C)C)c1)c1cc(N(c2cccc([Si](C)(C)C)c2)c2cc(-c3ccccc3)ccc2C)c2ccc3cc(C(C)(C)C)cc4ccc1c2c43 |
| InChI | InChI=1S/C64H64N2Si2/c1-43-28-30-47(45-20-14-12-15-21-45)38-58(43)65(52-24-18-26-54(40-52)67(6,7)8)60-42-61(57-35-33-50-37-51(64(3,4)5)36-49-32-34-56(60)63(57)62(49)50)66(53-25-19-27-55(41-53)68(9,10)11)59-39-48(31-29-44(59)2)46-22-16-13-17-23-46/h12-42H,1-11H3 |
| InChIKey | IHCTXKJJXCYODG-UHFFFAOYSA-N |
| XLogP | 17.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.40 |
| LogP ≤ 5 | 17.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|