C64H60N2 — CID 129062905
7-tert-butyl-1-N,3-N-bis(3-methylphenyl)-1-N,3-N-bis(5-phenyl-2-propan-2-ylphenyl)pyrene-1,3-diamine (PubChem CID 129062905) has the molecular formula C64H60N2 and a molecular weight of 857.20 g/mol. Its IUPAC name is 7-tert-butyl-1-N,3-N-bis(3-methylphenyl)-1-N,3-N-bis(5-phenyl-2-propan-2-ylphenyl)pyrene-1,3-diamine.
| Compound Name | 7-tert-butyl-1-N,3-N-bis(3-methylphenyl)-1-N,3-N-bis(5-phenyl-2-propan-2-ylphenyl)pyrene-1,3-diamine |
|---|---|
| PubChem CID | 129062905 |
| Molecular Formula | C64H60N2 |
| Molecular Weight | 857.20 g/mol |
| Exact Mass | 856.48 |
| IUPAC Name | 7-tert-butyl-1-N,3-N-bis(3-methylphenyl)-1-N,3-N-bis(5-phenyl-2-propan-2-ylphenyl)pyrene-1,3-diamine |
| SMILES | Cc1cccc(N(c2cc(-c3ccccc3)ccc2C(C)C)c2cc(N(c3cccc(C)c3)c3cc(-c4ccccc4)ccc3C(C)C)c3ccc4cc(C(C)(C)C)cc5ccc2c3c54)c1 |
| InChI | InChI=1S/C64H60N2/c1-41(2)54-30-26-47(45-20-12-10-13-21-45)38-58(54)65(52-24-16-18-43(5)34-52)60-40-61(57-33-29-50-37-51(64(7,8)9)36-49-28-32-56(60)63(57)62(49)50)66(53-25-17-19-44(6)35-53)59-39-48(27-31-55(59)42(3)4)46-22-14-11-15-23-46/h10-42H,1-9H3 |
| InChIKey | DRILPYASKKGNTR-UHFFFAOYSA-N |
| XLogP | 19.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.20 |
| LogP ≤ 5 | 19.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|