C14H20N4O2 — CID 144778788
ethane;N-[(2-methyl-3-oxo-5-pyridin-4-yl-1H-pyrazol-4-yl)methyl]acetamide (PubChem CID 144778788) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is ethane;N-[(2-methyl-3-oxo-5-pyridin-4-yl-1H-pyrazol-4-yl)methyl]acetamide.
| Compound Name | ethane;N-[(2-methyl-3-oxo-5-pyridin-4-yl-1H-pyrazol-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 144778788 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | ethane;N-[(2-methyl-3-oxo-5-pyridin-4-yl-1H-pyrazol-4-yl)methyl]acetamide |
| SMILES | CC.CC(=O)NCc1c(-c2ccncc2)[nH]n(C)c1=O |
| InChI | InChI=1S/C12H14N4O2.C2H6/c1-8(17)14-7-10-11(15-16(2)12(10)18)9-3-5-13-6-4-9;1-2/h3-6,15H,7H2,1-2H3,(H,14,17);1-2H3 |
| InChIKey | ZGXGAXUDPBDMEL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |