C8H13N3O2 — CID 121371043
N-[(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)methyl]acetamide (PubChem CID 121371043) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is N-[(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)methyl]acetamide.
| Compound Name | N-[(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 121371043 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | N-[(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)methyl]acetamide |
| SMILES | CC(=O)NCc1c(C)n(C)[nH]c1=O |
| InChI | InChI=1S/C8H13N3O2/c1-5-7(4-9-6(2)12)8(13)10-11(5)3/h4H2,1-3H3,(H,9,12)(H,10,13) |
| InChIKey | BOUJYCGOSGSBCH-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |