About (NZ)-N'-ethyl-2-oxo-N-propylidenepyrrolidine-1-carboximidamide
(NZ)-N'-ethyl-2-oxo-N-propylidenepyrrolidine-1-carboximidamide (PubChem CID 144779448) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is (NZ)-N'-ethyl-2-oxo-N-propylidenepyrrolidine-1-carboximidamide.
Molecular Properties
| Compound Name | (NZ)-N'-ethyl-2-oxo-N-propylidenepyrrolidine-1-carboximidamide |
| PubChem CID | 144779448 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (NZ)-N'-ethyl-2-oxo-N-propylidenepyrrolidine-1-carboximidamide |
| SMILES | CC/C=N\C(=N/CC)N1CCCC1=O |
| InChI | InChI=1S/C10H17N3O/c1-3-7-12-10(11-4-2)13-8-5-6-9(13)14/h7H,3-6,8H2,1-2H3/b11-10+,12-7- |
| InChIKey | ARMLRDOOCJUAJA-RFWXHOBXSA-N |
| XLogP | 1.47 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N'-ethyl-2-oxo-N-propylidenepyrrolidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N'-ethyl-2-oxo-N-propylidenepyrrolidine-1-carboximidamide?
The IUPAC name of (NZ)-N'-ethyl-2-oxo-N-propylidenepyrrolidine-1-carboximidamide (CID 144779448) is (NZ)-N'-ethyl-2-oxo-N-propylidenepyrrolidine-1-carboximidamide.
What is the SMILES notation for (NZ)-N'-ethyl-2-oxo-N-propylidenepyrrolidine-1-carboximidamide?
The canonical SMILES for (NZ)-N'-ethyl-2-oxo-N-propylidenepyrrolidine-1-carboximidamide is CC/C=N\C(=N/CC)N1CCCC1=O.
What is the InChIKey of (NZ)-N'-ethyl-2-oxo-N-propylidenepyrrolidine-1-carboximidamide?
The InChIKey is ARMLRDOOCJUAJA-RFWXHOBXSA-N. The full InChI is InChI=1S/C10H17N3O/c1-3-7-12-10(11-4-2)13-8-5-6-9(13)14/h7H,3-6,8H2,1-2H3/b11-10+,12-7-.
What are the key properties of (NZ)-N'-ethyl-2-oxo-N-propylidenepyrrolidine-1-carboximidamide?
(NZ)-N'-ethyl-2-oxo-N-propylidenepyrrolidine-1-carboximidamide has a molecular weight of 195.27 g/mol, XLogP of 1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N'-ethyl-2-oxo-N-propylidenepyrrolidine-1-carboximidamide is sourced from PubChem (CID 144779448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).