C24H24N4O2 — CID 144779762
5-(5-methoxy-3-pyridinyl)-3-phenyl-2-(propylaminomethyl)quinazolin-4-one (PubChem CID 144779762) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 5-(5-methoxy-3-pyridinyl)-3-phenyl-2-(propylaminomethyl)quinazolin-4-one.
| Compound Name | 5-(5-methoxy-3-pyridinyl)-3-phenyl-2-(propylaminomethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 144779762 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 5-(5-methoxy-3-pyridinyl)-3-phenyl-2-(propylaminomethyl)quinazolin-4-one |
| SMILES | CCCNCc1nc2cccc(-c3cncc(OC)c3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C24H24N4O2/c1-3-12-25-16-22-27-21-11-7-10-20(17-13-19(30-2)15-26-14-17)23(21)24(29)28(22)18-8-5-4-6-9-18/h4-11,13-15,25H,3,12,16H2,1-2H3 |
| InChIKey | GXEQIDOZWDNLGB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|