C20H28FN3O3 — CID 144780085
4-fluoro-N,3-dimethylaniline;1-methyl-4-oxaldehydoylpyrrole-2-carbaldehyde;2-methylpropan-2-amine (PubChem CID 144780085) has the molecular formula C20H28FN3O3 and a molecular weight of 377.46 g/mol. Its IUPAC name is 4-fluoro-N,3-dimethylaniline;1-methyl-4-oxaldehydoylpyrrole-2-carbaldehyde;2-methylpropan-2-amine.
| Compound Name | 4-fluoro-N,3-dimethylaniline;1-methyl-4-oxaldehydoylpyrrole-2-carbaldehyde;2-methylpropan-2-amine |
|---|---|
| PubChem CID | 144780085 |
| Molecular Formula | C20H28FN3O3 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 4-fluoro-N,3-dimethylaniline;1-methyl-4-oxaldehydoylpyrrole-2-carbaldehyde;2-methylpropan-2-amine |
| SMILES | CC(C)(C)N.CNc1ccc(F)c(C)c1.Cn1cc(C(=O)C=O)cc1C=O |
| InChI | InChI=1S/C8H10FN.C8H7NO3.C4H11N/c1-6-5-7(10-2)3-4-8(6)9;1-9-3-6(8(12)5-11)2-7(9)4-10;1-4(2,3)5/h3-5,10H,1-2H3;2-5H,1H3;5H2,1-3H3 |
| InChIKey | SXSRXGFMBMBRNY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|