C15H12F3N3O2 — CID 144784659
6-[[2-(methylamino)-6-(trifluoromethoxy)phenyl]methoxy]pyridine-2-carbonitrile (PubChem CID 144784659) has the molecular formula C15H12F3N3O2 and a molecular weight of 323.27 g/mol. Its IUPAC name is 6-[[2-(methylamino)-6-(trifluoromethoxy)phenyl]methoxy]pyridine-2-carbonitrile.
| Compound Name | 6-[[2-(methylamino)-6-(trifluoromethoxy)phenyl]methoxy]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 144784659 |
| Molecular Formula | C15H12F3N3O2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 6-[[2-(methylamino)-6-(trifluoromethoxy)phenyl]methoxy]pyridine-2-carbonitrile |
| SMILES | CNc1cccc(OC(F)(F)F)c1COc1cccc(C#N)n1 |
| InChI | InChI=1S/C15H12F3N3O2/c1-20-12-5-3-6-13(23-15(16,17)18)11(12)9-22-14-7-2-4-10(8-19)21-14/h2-7,20H,9H2,1H3 |
| InChIKey | FZTYEERDTCOLME-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |