C15H16ClF3N4O3 — CID 144784338
2-[(4-chloro-3-pyridinyl)oxymethyl]-N-methyl-3-(trifluoromethoxy)aniline;formohydrazide (PubChem CID 144784338) has the molecular formula C15H16ClF3N4O3 and a molecular weight of 392.77 g/mol. Its IUPAC name is 2-[(4-chloro-3-pyridinyl)oxymethyl]-N-methyl-3-(trifluoromethoxy)aniline;formohydrazide.
| Compound Name | 2-[(4-chloro-3-pyridinyl)oxymethyl]-N-methyl-3-(trifluoromethoxy)aniline;formohydrazide |
|---|---|
| PubChem CID | 144784338 |
| Molecular Formula | C15H16ClF3N4O3 |
| Molecular Weight | 392.77 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-[(4-chloro-3-pyridinyl)oxymethyl]-N-methyl-3-(trifluoromethoxy)aniline;formohydrazide |
| SMILES | CNc1cccc(OC(F)(F)F)c1COc1cnccc1Cl.NNC=O |
| InChI | InChI=1S/C14H12ClF3N2O2.CH4N2O/c1-19-11-3-2-4-12(22-14(16,17)18)9(11)8-21-13-7-20-6-5-10(13)15;2-3-1-4/h2-7,19H,8H2,1H3;1H,2H2,(H,3,4) |
| InChIKey | GTVYECHYDNLCPU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.77 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|