C14H26N2O — CID 144786750
ethane;1-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]piperazin-1-yl]ethanone (PubChem CID 144786750) has the molecular formula C14H26N2O and a molecular weight of 238.38 g/mol. Its IUPAC name is ethane;1-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]piperazin-1-yl]ethanone.
| Compound Name | ethane;1-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 144786750 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | ethane;1-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]piperazin-1-yl]ethanone |
| SMILES | C/C=C\C(=C/C)N1CCN(C(C)=O)CC1.CC |
| InChI | InChI=1S/C12H20N2O.C2H6/c1-4-6-12(5-2)14-9-7-13(8-10-14)11(3)15;1-2/h4-6H,7-10H2,1-3H3;1-2H3/b6-4-,12-5+; |
| InChIKey | WCIAGQXJAJKPNH-QRGVYOGNSA-N |
| XLogP | 2.66 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|